Organosulfur Compounds
Selleck Chemical LLC Bis
Bis(2-Methyl-3-furyl) disulfide is a volatile sulfur compound that is a key contributor to the meat-like aroma in cooked meat
Aobchem 1-(Cyclopropylmethyl)-1H-pyrazole | ≥97% | CAS 1344382-51-9 | C7H10N2 | 500mg
1-(Cyclopropylmethyl)-1H-pyrazole | ≥97% | CAS 1344382-51-9 | C7H10N2 | 500mg
eMolecules 55749-90-1 | 4-((4,6-DIMETHYLPYRIMIDIN-2-YL)OXY)ANILINE | AstaTech | MFCD01895360 | 215.256 | C12H13N3O | 95.000 | Cc1cc(C)nc(Oc2ccc(N)cc2)n1 | 1g | 200615109
4-((4,6-DIMETHYLPYRIMIDIN-2-YL)OXY)ANILINE | AstaTech | 55749-90-1 | MFCD01895360 | 215.256 | C12H13N3O | 95.000 | Cc1cc(C)nc(Oc2ccc(N)cc2)n1 | 1g | 200615109
eMolecules 148312-55-4 | tert-Butyl thiazolidine-3-carboxylate | MFCD22581582 | 1g
Ambeed | 2-Chloro-3-(4455-tetramethyl-132-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine | 250mg | 716947782 | A277029 | 2068737-11-9 | MFCD16996474 | 307.500 | C12H14BClF3NO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 505-10-2 | 3-Methylthio-1-propanol | Oakwood Chemical | MFCD00036560 | 106.180 | C4H10OS | 98.000 | CSCCCO | 1g | 537697811
3-Methylthio-1-propanol | Oakwood Chemical | 505-10-2 | MFCD00036560 | 106.180 | C4H10OS | 98.000 | CSCCCO | 1g | 537697811
eMolecules 88768-45-0 | (2-Pyrimidylthio)acetic acid | Oakwood Chemical | MFCD00010287 | 170.190 | C6H6N2O2S | 98.000 | OC(=O)CSc1ncccn1 | 5g | 537673966
(2-Pyrimidylthio)acetic acid | Oakwood Chemical | 88768-45-0 | MFCD00010287 | 170.190 | C6H6N2O2S | 98.000 | OC(=O)CSc1ncccn1 | 5g | 537673966
Apexbio Technology LLC Rhodamine B isothiocyanate 36877-69-7 50mg
Rhodamine B isothiocyanate (RBITC) is a fluorescent dye bearing an isothiocyanate functional group enabling its covalent conjugation specifically to amino groups in proteins and peptides Upon excitation by green light wavelengths this compound emits characteristic orange-red fluorescence allowing for visualization and detection of labeled biomolecules in cellular and tissue samples Due to its stable covalent binding to target proteins RBITC is employed extensively in fluorescence microscopy immunohistochemical analysis and in vitro labeling studies in disciplines such as cell biology neuroscience and immunology Its chemical structure facilitates selective attachment aiding the detailed investigation of cellular localization protein dynamics and molecular interactions in biological systems
eMolecules 349402-18-2 | N-(3-Methoxypropyl)-4-methyl-3-nitrobenzenesulfonamide | AA Blocks LLC | MFCD02229286 | 288.320 | C11H16N2O5S | 0.000 | COCCCNS(=O)(=O)c1ccc(C)c(c1)[N+]([O-])=O | 1g | 913106108
N-(3-Methoxypropyl)-4-methyl-3-nitrobenzenesulfonamide | AA Blocks LLC | 349402-18-2 | MFCD02229286 | 288.320 | C11H16N2O5S | 0.000 | COCCCNS(=O)(=O)c1ccc(C)c(c1)[N+]([O-])=O | 1g | 913106108
Apexbio Technology LLC Sulfathiazole 72-14-0 10g
Sulfathiazole (CAS 72-14-0) is a small-molecule inhibitor targeting dihydropteroate synthase (DHPS) It is designed to competitively inhibit bacterial folic acid synthesis thereby disrupting the folate pathway and impeding microbial growth Sulfathiazole exerts its biological activity primarily through inhibition of DHPS In in vitro studies sulfathiazole demonstrates bacteriostatic inhibition with IC50 values ranging from low to medium micromolar concentrations depending on specific bacterial strains and experimental conditions Based on these pharmacological properties sulfathiazole holds research potential in investigating antibacterial resistance metabolic pathways of pathogens and enzyme-substrate interactions in microbiological and biochemical research